C38H44N6O7S2 — CID 23628011
N-[5-[[4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]sulfamoyl]-4-methyl-1,3-thiazol-2-yl]acetamide (PubChem CID 23628011) has the molecular formula C38H44N6O7S2 and a molecular weight of 760.94 g/mol. Its IUPAC name is N-[5-[[4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]sulfamoyl]-4-methyl-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-[[4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]sulfamoyl]-4-methyl-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 23628011 |
| Molecular Formula | C38H44N6O7S2 |
| Molecular Weight | 760.94 g/mol |
| Exact Mass | 760.27 |
| IUPAC Name | N-[5-[[4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]sulfamoyl]-4-methyl-1,3-thiazol-2-yl]acetamide |
| SMILES | COc1ccc(C(CCCNS(=O)(=O)c2sc(NC(C)=O)nc2C)N2C(=O)c3cccc(N4CCN([C@H](C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C38H44N6O7S2/c1-24-37(52-38(40-24)41-26(3)45)53(48,49)39-18-10-15-30(28-16-17-32(50-4)33(23-28)51-5)44-35(46)29-13-9-14-31(34(29)36(44)47)43-21-19-42(20-22-43)25(2)27-11-7-6-8-12-27/h6-9,11-14,16-17,23,25,30,39H,10,15,18-22H2,1-5H3,(H,40,41,45)/t25-,30?/m1/s1 |
| InChIKey | BBWSETCBMBJOGP-GOWJNXQMSA-N |
| XLogP | 5.41 |
| TPSA | 150.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.94 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|