C39H41N5O7S2 — CID 23628013
N-[4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-5-(1,2-oxazol-3-yl)thiophene-2-sulfonamide (PubChem CID 23628013) has the molecular formula C39H41N5O7S2 and a molecular weight of 755.92 g/mol. Its IUPAC name is N-[4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-5-(1,2-oxazol-3-yl)thiophene-2-sulfonamide.
| Compound Name | N-[4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-5-(1,2-oxazol-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 23628013 |
| Molecular Formula | C39H41N5O7S2 |
| Molecular Weight | 755.92 g/mol |
| Exact Mass | 755.24 |
| IUPAC Name | N-[4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-5-(1,2-oxazol-3-yl)thiophene-2-sulfonamide |
| SMILES | COc1ccc(C(CCCNS(=O)(=O)c2ccc(-c3ccon3)s2)N2C(=O)c3cccc(N4CCN([C@H](C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C39H41N5O7S2/c1-26(27-9-5-4-6-10-27)42-20-22-43(23-21-42)32-12-7-11-29-37(32)39(46)44(38(29)45)31(28-14-15-33(49-2)34(25-28)50-3)13-8-19-40-53(47,48)36-17-16-35(52-36)30-18-24-51-41-30/h4-7,9-12,14-18,24-26,31,40H,8,13,19-23H2,1-3H3/t26-,31?/m1/s1 |
| InChIKey | RMJMTHGNGBMERO-SYQKMTEESA-N |
| XLogP | 6.40 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.92 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|