C37H39ClN6O6S2 — CID 23628071
6-chloro-N-[4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 23628071) has the molecular formula C37H39ClN6O6S2 and a molecular weight of 763.34 g/mol. Its IUPAC name is 6-chloro-N-[4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | 6-chloro-N-[4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 23628071 |
| Molecular Formula | C37H39ClN6O6S2 |
| Molecular Weight | 763.34 g/mol |
| Exact Mass | 762.21 |
| IUPAC Name | 6-chloro-N-[4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | COc1ccc(C(CCCNS(=O)(=O)c2c(Cl)nc3sccn23)N2C(=O)c3cccc(N4CCN([C@H](C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C37H39ClN6O6S2/c1-24(25-9-5-4-6-10-25)41-17-19-42(20-18-41)29-12-7-11-27-32(29)35(46)44(34(27)45)28(26-14-15-30(49-2)31(23-26)50-3)13-8-16-39-52(47,48)36-33(38)40-37-43(36)21-22-51-37/h4-7,9-12,14-15,21-24,28,39H,8,13,16-20H2,1-3H3/t24-,28?/m1/s1 |
| InChIKey | FTKQGDRCFFNQOK-RIBGEGAISA-N |
| XLogP | 6.05 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.34 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|