C26H24N4O4 — CID 23628120
2-[2-[4-[4-(1,2,4-triazol-1-yl)phenoxy]butoxy]carbazol-9-yl]acetic acid (PubChem CID 23628120) has the molecular formula C26H24N4O4 and a molecular weight of 456.50 g/mol. Its IUPAC name is 2-[2-[4-[4-(1,2,4-triazol-1-yl)phenoxy]butoxy]carbazol-9-yl]acetic acid.
| Compound Name | 2-[2-[4-[4-(1,2,4-triazol-1-yl)phenoxy]butoxy]carbazol-9-yl]acetic acid |
|---|---|
| PubChem CID | 23628120 |
| Molecular Formula | C26H24N4O4 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 2-[2-[4-[4-(1,2,4-triazol-1-yl)phenoxy]butoxy]carbazol-9-yl]acetic acid |
| SMILES | O=C(O)Cn1c2ccccc2c2ccc(OCCCCOc3ccc(-n4cncn4)cc3)cc21 |
| InChI | InChI=1S/C26H24N4O4/c31-26(32)16-29-24-6-2-1-5-22(24)23-12-11-21(15-25(23)29)34-14-4-3-13-33-20-9-7-19(8-10-20)30-18-27-17-28-30/h1-2,5-12,15,17-18H,3-4,13-14,16H2,(H,31,32) |
| InChIKey | GIYQQHDUCNHIIK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|