C20H24O5 — CID 23628522
(2R,3S)-2-[(1S,2S,3S)-3-[(4-methoxyphenyl)methoxy]-2-methyl-5-methylidenecyclopentyl]-5-oxooxolane-3-carbaldehyde (PubChem CID 23628522) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (2R,3S)-2-[(1S,2S,3S)-3-[(4-methoxyphenyl)methoxy]-2-methyl-5-methylidenecyclopentyl]-5-oxooxolane-3-carbaldehyde.
| Compound Name | (2R,3S)-2-[(1S,2S,3S)-3-[(4-methoxyphenyl)methoxy]-2-methyl-5-methylidenecyclopentyl]-5-oxooxolane-3-carbaldehyde |
|---|---|
| PubChem CID | 23628522 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (2R,3S)-2-[(1S,2S,3S)-3-[(4-methoxyphenyl)methoxy]-2-methyl-5-methylidenecyclopentyl]-5-oxooxolane-3-carbaldehyde |
| SMILES | C=C1C[C@H](OCc2ccc(OC)cc2)[C@@H](C)[C@@H]1[C@H]1OC(=O)C[C@@H]1C=O |
| InChI | InChI=1S/C20H24O5/c1-12-8-17(24-11-14-4-6-16(23-3)7-5-14)13(2)19(12)20-15(10-21)9-18(22)25-20/h4-7,10,13,15,17,19-20H,1,8-9,11H2,2-3H3/t13-,15-,17+,19-,20+/m1/s1 |
| InChIKey | SINDBEIFEIIJJV-KQOJVLMTSA-N |
| XLogP | 2.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|