About butyl-[2-[(3R,5S)-5-carboxypyrrolidin-3-yl]oxy-2-oxoethyl]-dimethylazanium
butyl-[2-[(3R,5S)-5-carboxypyrrolidin-3-yl]oxy-2-oxoethyl]-dimethylazanium (PubChem CID 23629006) has the molecular formula C13H25N2O4+
and a molecular weight of 273.35 g/mol. Its IUPAC name is butyl-[2-[(3R,5S)-5-carboxypyrrolidin-3-yl]oxy-2-oxoethyl]-dimethylazanium.
Molecular Properties
| Compound Name | butyl-[2-[(3R,5S)-5-carboxypyrrolidin-3-yl]oxy-2-oxoethyl]-dimethylazanium |
| PubChem CID | 23629006 |
| Molecular Formula | C13H25N2O4+ |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | butyl-[2-[(3R,5S)-5-carboxypyrrolidin-3-yl]oxy-2-oxoethyl]-dimethylazanium |
| SMILES | CCCC[N+](C)(C)CC(=O)O[C@H]1CN[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C13H24N2O4/c1-4-5-6-15(2,3)9-12(16)19-10-7-11(13(17)18)14-8-10/h10-11,14H,4-9H2,1-3H3/p+1/t10-,11+/m1/s1 |
| InChIKey | UPXFZICOEHOBTB-MNOVXSKESA-O |
| XLogP | 0.22 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze butyl-[2-[(3R,5S)-5-carboxypyrrolidin-3-yl]oxy-2-oxoethyl]-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl-[2-[(3R,5S)-5-carboxypyrrolidin-3-yl]oxy-2-oxoethyl]-dimethylazanium?
The IUPAC name of butyl-[2-[(3R,5S)-5-carboxypyrrolidin-3-yl]oxy-2-oxoethyl]-dimethylazanium (CID 23629006) is butyl-[2-[(3R,5S)-5-carboxypyrrolidin-3-yl]oxy-2-oxoethyl]-dimethylazanium.
What is the SMILES notation for butyl-[2-[(3R,5S)-5-carboxypyrrolidin-3-yl]oxy-2-oxoethyl]-dimethylazanium?
The canonical SMILES for butyl-[2-[(3R,5S)-5-carboxypyrrolidin-3-yl]oxy-2-oxoethyl]-dimethylazanium is CCCC[N+](C)(C)CC(=O)O[C@H]1CN[C@H](C(=O)O)C1.
What is the InChIKey of butyl-[2-[(3R,5S)-5-carboxypyrrolidin-3-yl]oxy-2-oxoethyl]-dimethylazanium?
The InChIKey is UPXFZICOEHOBTB-MNOVXSKESA-O. The full InChI is InChI=1S/C13H24N2O4/c1-4-5-6-15(2,3)9-12(16)19-10-7-11(13(17)18)14-8-10/h10-11,14H,4-9H2,1-3H3/p+1/t10-,11+/m1/s1.
What are the key properties of butyl-[2-[(3R,5S)-5-carboxypyrrolidin-3-yl]oxy-2-oxoethyl]-dimethylazanium?
butyl-[2-[(3R,5S)-5-carboxypyrrolidin-3-yl]oxy-2-oxoethyl]-dimethylazanium has a molecular weight of 273.35 g/mol, XLogP of 0.22, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl-[2-[(3R,5S)-5-carboxypyrrolidin-3-yl]oxy-2-oxoethyl]-dimethylazanium is sourced from PubChem (CID 23629006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).