C23H25NO3S — CID 23629180
(3aS,4E,9aR)-2-(4-methylphenyl)sulfonyl-5-phenyl-3,3a,6,7,9,9a-hexahydro-1H-cycloocta[c]pyrrol-8-one (PubChem CID 23629180) has the molecular formula C23H25NO3S and a molecular weight of 395.52 g/mol. Its IUPAC name is (3aS,4E,9aR)-2-(4-methylphenyl)sulfonyl-5-phenyl-3,3a,6,7,9,9a-hexahydro-1H-cycloocta[c]pyrrol-8-one.
| Compound Name | (3aS,4E,9aR)-2-(4-methylphenyl)sulfonyl-5-phenyl-3,3a,6,7,9,9a-hexahydro-1H-cycloocta[c]pyrrol-8-one |
|---|---|
| PubChem CID | 23629180 |
| Molecular Formula | C23H25NO3S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (3aS,4E,9aR)-2-(4-methylphenyl)sulfonyl-5-phenyl-3,3a,6,7,9,9a-hexahydro-1H-cycloocta[c]pyrrol-8-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H]3CC(=O)CC/C(c4ccccc4)=C\[C@@H]3C2)cc1 |
| InChI | InChI=1S/C23H25NO3S/c1-17-7-11-23(12-8-17)28(26,27)24-15-20-13-19(18-5-3-2-4-6-18)9-10-22(25)14-21(20)16-24/h2-8,11-13,20-21H,9-10,14-16H2,1H3/b19-13+/t20-,21+/m1/s1 |
| InChIKey | JOWNLORMGZICBY-DZQQXJBLSA-N |
| XLogP | 4.07 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |