About [(2S)-1-(5-benzyl-2,4-dioxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid
[(2S)-1-(5-benzyl-2,4-dioxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid (PubChem CID 23629631) has the molecular formula C15H19N2O7P
and a molecular weight of 370.30 g/mol. Its IUPAC name is [(2S)-1-(5-benzyl-2,4-dioxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid.
Molecular Properties
| Compound Name | [(2S)-1-(5-benzyl-2,4-dioxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid |
| PubChem CID | 23629631 |
| Molecular Formula | C15H19N2O7P |
| Molecular Weight | 370.30 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | [(2S)-1-(5-benzyl-2,4-dioxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid |
| SMILES | O=c1[nH]c(=O)n(C[C@@H](CO)OCP(=O)(O)O)cc1Cc1ccccc1 |
| InChI | InChI=1S/C15H19N2O7P/c18-9-13(24-10-25(21,22)23)8-17-7-12(14(19)16-15(17)20)6-11-4-2-1-3-5-11/h1-5,7,13,18H,6,8-10H2,(H,16,19,20)(H2,21,22,23)/t13-/m0/s1 |
| InChIKey | MYLZRGRQCFYNRW-ZDUSSCGKSA-N |
| XLogP | -0.36 |
| TPSA | 141.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.30 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-1-(5-benzyl-2,4-dioxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-(5-benzyl-2,4-dioxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid?
The IUPAC name of [(2S)-1-(5-benzyl-2,4-dioxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid (CID 23629631) is [(2S)-1-(5-benzyl-2,4-dioxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid.
What is the SMILES notation for [(2S)-1-(5-benzyl-2,4-dioxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid?
The canonical SMILES for [(2S)-1-(5-benzyl-2,4-dioxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid is O=c1[nH]c(=O)n(C[C@@H](CO)OCP(=O)(O)O)cc1Cc1ccccc1.
What is the InChIKey of [(2S)-1-(5-benzyl-2,4-dioxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid?
The InChIKey is MYLZRGRQCFYNRW-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H19N2O7P/c18-9-13(24-10-25(21,22)23)8-17-7-12(14(19)16-15(17)20)6-11-4-2-1-3-5-11/h1-5,7,13,18H,6,8-10H2,(H,16,19,20)(H2,21,22,23)/t13-/m0/s1.
What are the key properties of [(2S)-1-(5-benzyl-2,4-dioxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid?
[(2S)-1-(5-benzyl-2,4-dioxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid has a molecular weight of 370.30 g/mol, XLogP of -0.36, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-(5-benzyl-2,4-dioxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid is sourced from PubChem (CID 23629631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).