About 2-oxo-N,N-di(propan-2-yl)-1,3-dihydroimidazole-4-carboxamide
2-oxo-N,N-di(propan-2-yl)-1,3-dihydroimidazole-4-carboxamide (PubChem CID 23629750) has the molecular formula C10H17N3O2
and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-oxo-N,N-di(propan-2-yl)-1,3-dihydroimidazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-oxo-N,N-di(propan-2-yl)-1,3-dihydroimidazole-4-carboxamide |
| PubChem CID | 23629750 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 2-oxo-N,N-di(propan-2-yl)-1,3-dihydroimidazole-4-carboxamide |
| SMILES | CC(C)N(C(=O)c1c[nH]c(=O)[nH]1)C(C)C |
| InChI | InChI=1S/C10H17N3O2/c1-6(2)13(7(3)4)9(14)8-5-11-10(15)12-8/h5-7H,1-4H3,(H2,11,12,15) |
| InChIKey | YNJRJBLBYIJBJL-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-oxo-N,N-di(propan-2-yl)-1,3-dihydroimidazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-N,N-di(propan-2-yl)-1,3-dihydroimidazole-4-carboxamide?
The IUPAC name of 2-oxo-N,N-di(propan-2-yl)-1,3-dihydroimidazole-4-carboxamide (CID 23629750) is 2-oxo-N,N-di(propan-2-yl)-1,3-dihydroimidazole-4-carboxamide.
What is the SMILES notation for 2-oxo-N,N-di(propan-2-yl)-1,3-dihydroimidazole-4-carboxamide?
The canonical SMILES for 2-oxo-N,N-di(propan-2-yl)-1,3-dihydroimidazole-4-carboxamide is CC(C)N(C(=O)c1c[nH]c(=O)[nH]1)C(C)C.
What is the InChIKey of 2-oxo-N,N-di(propan-2-yl)-1,3-dihydroimidazole-4-carboxamide?
The InChIKey is YNJRJBLBYIJBJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2/c1-6(2)13(7(3)4)9(14)8-5-11-10(15)12-8/h5-7H,1-4H3,(H2,11,12,15).
What are the key properties of 2-oxo-N,N-di(propan-2-yl)-1,3-dihydroimidazole-4-carboxamide?
2-oxo-N,N-di(propan-2-yl)-1,3-dihydroimidazole-4-carboxamide has a molecular weight of 211.26 g/mol, XLogP of 0.96, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-N,N-di(propan-2-yl)-1,3-dihydroimidazole-4-carboxamide is sourced from PubChem (CID 23629750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).