About N,N-di(butan-2-yl)-2-oxo-1,3-dihydroimidazole-4-carboxamide
N,N-di(butan-2-yl)-2-oxo-1,3-dihydroimidazole-4-carboxamide (PubChem CID 23629777) has the molecular formula C12H21N3O2
and a molecular weight of 239.32 g/mol. Its IUPAC name is N,N-di(butan-2-yl)-2-oxo-1,3-dihydroimidazole-4-carboxamide.
Molecular Properties
| Compound Name | N,N-di(butan-2-yl)-2-oxo-1,3-dihydroimidazole-4-carboxamide |
| PubChem CID | 23629777 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | N,N-di(butan-2-yl)-2-oxo-1,3-dihydroimidazole-4-carboxamide |
| SMILES | CCC(C)N(C(=O)c1c[nH]c(=O)[nH]1)C(C)CC |
| InChI | InChI=1S/C12H21N3O2/c1-5-8(3)15(9(4)6-2)11(16)10-7-13-12(17)14-10/h7-9H,5-6H2,1-4H3,(H2,13,14,17) |
| InChIKey | LVFPBGNHEJVGPG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-di(butan-2-yl)-2-oxo-1,3-dihydroimidazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-di(butan-2-yl)-2-oxo-1,3-dihydroimidazole-4-carboxamide?
The IUPAC name of N,N-di(butan-2-yl)-2-oxo-1,3-dihydroimidazole-4-carboxamide (CID 23629777) is N,N-di(butan-2-yl)-2-oxo-1,3-dihydroimidazole-4-carboxamide.
What is the SMILES notation for N,N-di(butan-2-yl)-2-oxo-1,3-dihydroimidazole-4-carboxamide?
The canonical SMILES for N,N-di(butan-2-yl)-2-oxo-1,3-dihydroimidazole-4-carboxamide is CCC(C)N(C(=O)c1c[nH]c(=O)[nH]1)C(C)CC.
What is the InChIKey of N,N-di(butan-2-yl)-2-oxo-1,3-dihydroimidazole-4-carboxamide?
The InChIKey is LVFPBGNHEJVGPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O2/c1-5-8(3)15(9(4)6-2)11(16)10-7-13-12(17)14-10/h7-9H,5-6H2,1-4H3,(H2,13,14,17).
What are the key properties of N,N-di(butan-2-yl)-2-oxo-1,3-dihydroimidazole-4-carboxamide?
N,N-di(butan-2-yl)-2-oxo-1,3-dihydroimidazole-4-carboxamide has a molecular weight of 239.32 g/mol, XLogP of 1.74, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-di(butan-2-yl)-2-oxo-1,3-dihydroimidazole-4-carboxamide is sourced from PubChem (CID 23629777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).