About 2-oxo-N-pentyl-1,3-dihydroimidazole-4-carboxamide
2-oxo-N-pentyl-1,3-dihydroimidazole-4-carboxamide (PubChem CID 23629779) has the molecular formula C9H15N3O2
and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-oxo-N-pentyl-1,3-dihydroimidazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-oxo-N-pentyl-1,3-dihydroimidazole-4-carboxamide |
| PubChem CID | 23629779 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-oxo-N-pentyl-1,3-dihydroimidazole-4-carboxamide |
| SMILES | CCCCCNC(=O)c1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C9H15N3O2/c1-2-3-4-5-10-8(13)7-6-11-9(14)12-7/h6H,2-5H2,1H3,(H,10,13)(H2,11,12,14) |
| InChIKey | AOUWKIFRMZYCGP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-N-pentyl-1,3-dihydroimidazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-N-pentyl-1,3-dihydroimidazole-4-carboxamide?
The IUPAC name of 2-oxo-N-pentyl-1,3-dihydroimidazole-4-carboxamide (CID 23629779) is 2-oxo-N-pentyl-1,3-dihydroimidazole-4-carboxamide.
What is the SMILES notation for 2-oxo-N-pentyl-1,3-dihydroimidazole-4-carboxamide?
The canonical SMILES for 2-oxo-N-pentyl-1,3-dihydroimidazole-4-carboxamide is CCCCCNC(=O)c1c[nH]c(=O)[nH]1.
What is the InChIKey of 2-oxo-N-pentyl-1,3-dihydroimidazole-4-carboxamide?
The InChIKey is AOUWKIFRMZYCGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2/c1-2-3-4-5-10-8(13)7-6-11-9(14)12-7/h6H,2-5H2,1H3,(H,10,13)(H2,11,12,14).
What are the key properties of 2-oxo-N-pentyl-1,3-dihydroimidazole-4-carboxamide?
2-oxo-N-pentyl-1,3-dihydroimidazole-4-carboxamide has a molecular weight of 197.24 g/mol, XLogP of 0.62, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-N-pentyl-1,3-dihydroimidazole-4-carboxamide is sourced from PubChem (CID 23629779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).