About 2-methyl-N-(2-methyl-1,3-thiazol-5-yl)-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide
2-methyl-N-(2-methyl-1,3-thiazol-5-yl)-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide (PubChem CID 23630124) has the molecular formula C20H16F3N3O2S
and a molecular weight of 419.43 g/mol. Its IUPAC name is 2-methyl-N-(2-methyl-1,3-thiazol-5-yl)-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide.
Molecular Properties
| Compound Name | 2-methyl-N-(2-methyl-1,3-thiazol-5-yl)-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide |
| PubChem CID | 23630124 |
| Molecular Formula | C20H16F3N3O2S |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 2-methyl-N-(2-methyl-1,3-thiazol-5-yl)-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide |
| SMILES | Cc1ncc(NC(=O)c2cc(NC(=O)c3cccc(C(F)(F)F)c3)ccc2C)s1 |
| InChI | InChI=1S/C20H16F3N3O2S/c1-11-6-7-15(9-16(11)19(28)26-17-10-24-12(2)29-17)25-18(27)13-4-3-5-14(8-13)20(21,22)23/h3-10H,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | PZWWCIFJQKDZMU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-N-(2-methyl-1,3-thiazol-5-yl)-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(2-methyl-1,3-thiazol-5-yl)-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide?
The IUPAC name of 2-methyl-N-(2-methyl-1,3-thiazol-5-yl)-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide (CID 23630124) is 2-methyl-N-(2-methyl-1,3-thiazol-5-yl)-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide.
What is the SMILES notation for 2-methyl-N-(2-methyl-1,3-thiazol-5-yl)-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide?
The canonical SMILES for 2-methyl-N-(2-methyl-1,3-thiazol-5-yl)-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide is Cc1ncc(NC(=O)c2cc(NC(=O)c3cccc(C(F)(F)F)c3)ccc2C)s1.
What is the InChIKey of 2-methyl-N-(2-methyl-1,3-thiazol-5-yl)-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide?
The InChIKey is PZWWCIFJQKDZMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16F3N3O2S/c1-11-6-7-15(9-16(11)19(28)26-17-10-24-12(2)29-17)25-18(27)13-4-3-5-14(8-13)20(21,22)23/h3-10H,1-2H3,(H,25,27)(H,26,28).
What are the key properties of 2-methyl-N-(2-methyl-1,3-thiazol-5-yl)-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide?
2-methyl-N-(2-methyl-1,3-thiazol-5-yl)-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide has a molecular weight of 419.43 g/mol, XLogP of 5.28, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(2-methyl-1,3-thiazol-5-yl)-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide is sourced from PubChem (CID 23630124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).