About (3S)-3-[[(3S)-3,7-diaminoheptanoyl]amino]-4-phenylbutanoic acid
(3S)-3-[[(3S)-3,7-diaminoheptanoyl]amino]-4-phenylbutanoic acid (PubChem CID 23630521) has the molecular formula C17H27N3O3
and a molecular weight of 321.42 g/mol. Its IUPAC name is (3S)-3-[[(3S)-3,7-diaminoheptanoyl]amino]-4-phenylbutanoic acid.
Molecular Properties
| Compound Name | (3S)-3-[[(3S)-3,7-diaminoheptanoyl]amino]-4-phenylbutanoic acid |
| PubChem CID | 23630521 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | (3S)-3-[[(3S)-3,7-diaminoheptanoyl]amino]-4-phenylbutanoic acid |
| SMILES | NCCCC[C@H](N)CC(=O)N[C@H](CC(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C17H27N3O3/c18-9-5-4-8-14(19)11-16(21)20-15(12-17(22)23)10-13-6-2-1-3-7-13/h1-3,6-7,14-15H,4-5,8-12,18-19H2,(H,20,21)(H,22,23)/t14-,15-/m0/s1 |
| InChIKey | IMZZTSJHWFXEQF-GJZGRUSLSA-N |
| XLogP | 1.03 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-[[(3S)-3,7-diaminoheptanoyl]amino]-4-phenylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[[(3S)-3,7-diaminoheptanoyl]amino]-4-phenylbutanoic acid?
The IUPAC name of (3S)-3-[[(3S)-3,7-diaminoheptanoyl]amino]-4-phenylbutanoic acid (CID 23630521) is (3S)-3-[[(3S)-3,7-diaminoheptanoyl]amino]-4-phenylbutanoic acid.
What is the SMILES notation for (3S)-3-[[(3S)-3,7-diaminoheptanoyl]amino]-4-phenylbutanoic acid?
The canonical SMILES for (3S)-3-[[(3S)-3,7-diaminoheptanoyl]amino]-4-phenylbutanoic acid is NCCCC[C@H](N)CC(=O)N[C@H](CC(=O)O)Cc1ccccc1.
What is the InChIKey of (3S)-3-[[(3S)-3,7-diaminoheptanoyl]amino]-4-phenylbutanoic acid?
The InChIKey is IMZZTSJHWFXEQF-GJZGRUSLSA-N. The full InChI is InChI=1S/C17H27N3O3/c18-9-5-4-8-14(19)11-16(21)20-15(12-17(22)23)10-13-6-2-1-3-7-13/h1-3,6-7,14-15H,4-5,8-12,18-19H2,(H,20,21)(H,22,23)/t14-,15-/m0/s1.
What are the key properties of (3S)-3-[[(3S)-3,7-diaminoheptanoyl]amino]-4-phenylbutanoic acid?
(3S)-3-[[(3S)-3,7-diaminoheptanoyl]amino]-4-phenylbutanoic acid has a molecular weight of 321.42 g/mol, XLogP of 1.03, 11 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[[(3S)-3,7-diaminoheptanoyl]amino]-4-phenylbutanoic acid is sourced from PubChem (CID 23630521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).