C22H29NO6 — CID 23630639
dimethyl (3E,4R)-1,4-dimethyl-3-[(3R)-3-methyl-4-phenylmethoxybutylidene]-5-oxopyrrolidine-2,2-dicarboxylate (PubChem CID 23630639) has the molecular formula C22H29NO6 and a molecular weight of 403.48 g/mol. Its IUPAC name is dimethyl (3E,4R)-1,4-dimethyl-3-[(3R)-3-methyl-4-phenylmethoxybutylidene]-5-oxopyrrolidine-2,2-dicarboxylate.
| Compound Name | dimethyl (3E,4R)-1,4-dimethyl-3-[(3R)-3-methyl-4-phenylmethoxybutylidene]-5-oxopyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 23630639 |
| Molecular Formula | C22H29NO6 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | dimethyl (3E,4R)-1,4-dimethyl-3-[(3R)-3-methyl-4-phenylmethoxybutylidene]-5-oxopyrrolidine-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)/C(=C/C[C@@H](C)COCc2ccccc2)[C@@H](C)C(=O)N1C |
| InChI | InChI=1S/C22H29NO6/c1-15(13-29-14-17-9-7-6-8-10-17)11-12-18-16(2)19(24)23(3)22(18,20(25)27-4)21(26)28-5/h6-10,12,15-16H,11,13-14H2,1-5H3/b18-12+/t15-,16-/m1/s1 |
| InChIKey | YKQDRJYYAAYECK-SUBKYJBBSA-N |
| XLogP | 2.35 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|