C32H34I2N2O4 — CID 23630701
1-[[4-[(6,7-dimethoxy-2-methylisoquinolin-2-ium-1-yl)methyl]phenyl]methyl]-6,7-dimethoxy-2-methylisoquinolin-2-ium diiodide (PubChem CID 23630701) has the molecular formula C32H34I2N2O4 and a molecular weight of 764.44 g/mol. Its IUPAC name is 1-[[4-[(6,7-dimethoxy-2-methylisoquinolin-2-ium-1-yl)methyl]phenyl]methyl]-6,7-dimethoxy-2-methylisoquinolin-2-ium diiodide.
| Compound Name | 1-[[4-[(6,7-dimethoxy-2-methylisoquinolin-2-ium-1-yl)methyl]phenyl]methyl]-6,7-dimethoxy-2-methylisoquinolin-2-ium diiodide |
|---|---|
| PubChem CID | 23630701 |
| Molecular Formula | C32H34I2N2O4 |
| Molecular Weight | 764.44 g/mol |
| Exact Mass | 764.06 |
| IUPAC Name | 1-[[4-[(6,7-dimethoxy-2-methylisoquinolin-2-ium-1-yl)methyl]phenyl]methyl]-6,7-dimethoxy-2-methylisoquinolin-2-ium diiodide |
| SMILES | COc1cc2cc[n+](C)c(Cc3ccc(Cc4c5cc(OC)c(OC)cc5cc[n+]4C)cc3)c2cc1OC.[I-].[I-] |
| InChI | InChI=1S/C32H34N2O4.2HI/c1-33-13-11-23-17-29(35-3)31(37-5)19-25(23)27(33)15-21-7-9-22(10-8-21)16-28-26-20-32(38-6)30(36-4)18-24(26)12-14-34(28)2;;/h7-14,17-20H,15-16H2,1-6H3;2*1H/q+2;;/p-2 |
| InChIKey | JMLFUVPKSAEZPU-UHFFFAOYSA-L |
| XLogP | -1.13 |
| TPSA | 44.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.44 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|