About [(3R,5S)-1-benzyl-5-(fluoromethyl)pyrrolidin-3-yl]oxy-tri(propan-2-yl)silane
[(3R,5S)-1-benzyl-5-(fluoromethyl)pyrrolidin-3-yl]oxy-tri(propan-2-yl)silane (PubChem CID 23630783) has the molecular formula C21H36FNOSi
and a molecular weight of 365.61 g/mol. Its IUPAC name is [(3R,5S)-1-benzyl-5-(fluoromethyl)pyrrolidin-3-yl]oxy-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | [(3R,5S)-1-benzyl-5-(fluoromethyl)pyrrolidin-3-yl]oxy-tri(propan-2-yl)silane |
| PubChem CID | 23630783 |
| Molecular Formula | C21H36FNOSi |
| Molecular Weight | 365.61 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | [(3R,5S)-1-benzyl-5-(fluoromethyl)pyrrolidin-3-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](O[C@@H]1C[C@@H](CF)N(Cc2ccccc2)C1)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H36FNOSi/c1-16(2)25(17(3)4,18(5)6)24-21-12-20(13-22)23(15-21)14-19-10-8-7-9-11-19/h7-11,16-18,20-21H,12-15H2,1-6H3/t20-,21+/m0/s1 |
| InChIKey | UMWKGSNJUREVNS-LEWJYISDSA-N |
| XLogP | 5.79 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.61 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(3R,5S)-1-benzyl-5-(fluoromethyl)pyrrolidin-3-yl]oxy-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,5S)-1-benzyl-5-(fluoromethyl)pyrrolidin-3-yl]oxy-tri(propan-2-yl)silane?
The IUPAC name of [(3R,5S)-1-benzyl-5-(fluoromethyl)pyrrolidin-3-yl]oxy-tri(propan-2-yl)silane (CID 23630783) is [(3R,5S)-1-benzyl-5-(fluoromethyl)pyrrolidin-3-yl]oxy-tri(propan-2-yl)silane.
What is the SMILES notation for [(3R,5S)-1-benzyl-5-(fluoromethyl)pyrrolidin-3-yl]oxy-tri(propan-2-yl)silane?
The canonical SMILES for [(3R,5S)-1-benzyl-5-(fluoromethyl)pyrrolidin-3-yl]oxy-tri(propan-2-yl)silane is CC(C)[Si](O[C@@H]1C[C@@H](CF)N(Cc2ccccc2)C1)(C(C)C)C(C)C.
What is the InChIKey of [(3R,5S)-1-benzyl-5-(fluoromethyl)pyrrolidin-3-yl]oxy-tri(propan-2-yl)silane?
The InChIKey is UMWKGSNJUREVNS-LEWJYISDSA-N. The full InChI is InChI=1S/C21H36FNOSi/c1-16(2)25(17(3)4,18(5)6)24-21-12-20(13-22)23(15-21)14-19-10-8-7-9-11-19/h7-11,16-18,20-21H,12-15H2,1-6H3/t20-,21+/m0/s1.
What are the key properties of [(3R,5S)-1-benzyl-5-(fluoromethyl)pyrrolidin-3-yl]oxy-tri(propan-2-yl)silane?
[(3R,5S)-1-benzyl-5-(fluoromethyl)pyrrolidin-3-yl]oxy-tri(propan-2-yl)silane has a molecular weight of 365.61 g/mol, XLogP of 5.79, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,5S)-1-benzyl-5-(fluoromethyl)pyrrolidin-3-yl]oxy-tri(propan-2-yl)silane is sourced from PubChem (CID 23630783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).