C34H38I2N2O6 — CID 23630794
6,7,8-trimethoxy-2-methyl-1-[[4-[(6,7,8-trimethoxy-2-methylisoquinolin-2-ium-1-yl)methyl]phenyl]methyl]isoquinolin-2-ium diiodide (PubChem CID 23630794) has the molecular formula C34H38I2N2O6 and a molecular weight of 824.49 g/mol. Its IUPAC name is 6,7,8-trimethoxy-2-methyl-1-[[4-[(6,7,8-trimethoxy-2-methylisoquinolin-2-ium-1-yl)methyl]phenyl]methyl]isoquinolin-2-ium diiodide.
| Compound Name | 6,7,8-trimethoxy-2-methyl-1-[[4-[(6,7,8-trimethoxy-2-methylisoquinolin-2-ium-1-yl)methyl]phenyl]methyl]isoquinolin-2-ium diiodide |
|---|---|
| PubChem CID | 23630794 |
| Molecular Formula | C34H38I2N2O6 |
| Molecular Weight | 824.49 g/mol |
| Exact Mass | 824.08 |
| IUPAC Name | 6,7,8-trimethoxy-2-methyl-1-[[4-[(6,7,8-trimethoxy-2-methylisoquinolin-2-ium-1-yl)methyl]phenyl]methyl]isoquinolin-2-ium diiodide |
| SMILES | COc1cc2cc[n+](C)c(Cc3ccc(Cc4c5c(OC)c(OC)c(OC)cc5cc[n+]4C)cc3)c2c(OC)c1OC.[I-].[I-] |
| InChI | InChI=1S/C34H38N2O6.2HI/c1-35-15-13-23-19-27(37-3)31(39-5)33(41-7)29(23)25(35)17-21-9-11-22(12-10-21)18-26-30-24(14-16-36(26)2)20-28(38-4)32(40-6)34(30)42-8;;/h9-16,19-20H,17-18H2,1-8H3;2*1H/q+2;;/p-2 |
| InChIKey | JBMDQWPWTLSICG-UHFFFAOYSA-L |
| XLogP | -1.12 |
| TPSA | 63.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.49 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|