C21H30O6 — CID 23630953
triethyl (3aR,6S,8aS)-8a-methyl-4-methylidene-3,3a,5,6-tetrahydro-1H-azulene-2,2,6-tricarboxylate (PubChem CID 23630953) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is triethyl (3aR,6S,8aS)-8a-methyl-4-methylidene-3,3a,5,6-tetrahydro-1H-azulene-2,2,6-tricarboxylate.
| Compound Name | triethyl (3aR,6S,8aS)-8a-methyl-4-methylidene-3,3a,5,6-tetrahydro-1H-azulene-2,2,6-tricarboxylate |
|---|---|
| PubChem CID | 23630953 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | triethyl (3aR,6S,8aS)-8a-methyl-4-methylidene-3,3a,5,6-tetrahydro-1H-azulene-2,2,6-tricarboxylate |
| SMILES | C=C1C[C@H](C(=O)OCC)C=C[C@]2(C)CC(C(=O)OCC)(C(=O)OCC)C[C@H]12 |
| InChI | InChI=1S/C21H30O6/c1-6-25-17(22)15-9-10-20(5)13-21(18(23)26-7-2,19(24)27-8-3)12-16(20)14(4)11-15/h9-10,15-16H,4,6-8,11-13H2,1-3,5H3/t15-,16-,20-/m1/s1 |
| InChIKey | LHOTVUOHWJKDBI-JXXFODFXSA-N |
| XLogP | 3.21 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|