C15H17ClO2 — CID 23631042
5-(4-chlorophenyl)-5-hydroxy-2-methylocta-1,7-dien-3-one (PubChem CID 23631042) has the molecular formula C15H17ClO2 and a molecular weight of 264.75 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-5-hydroxy-2-methylocta-1,7-dien-3-one.
| Compound Name | 5-(4-chlorophenyl)-5-hydroxy-2-methylocta-1,7-dien-3-one |
|---|---|
| PubChem CID | 23631042 |
| Molecular Formula | C15H17ClO2 |
| Molecular Weight | 264.75 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 5-(4-chlorophenyl)-5-hydroxy-2-methylocta-1,7-dien-3-one |
| SMILES | C=CCC(O)(CC(=O)C(=C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H17ClO2/c1-4-9-15(18,10-14(17)11(2)3)12-5-7-13(16)8-6-12/h4-8,18H,1-2,9-10H2,3H3 |
| InChIKey | WYZUFCZCEPZWBT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.75 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|