C16H20BNO2S — CID 23631076
5-methyl-2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole (PubChem CID 23631076) has the molecular formula C16H20BNO2S and a molecular weight of 301.22 g/mol. Its IUPAC name is 5-methyl-2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole.
| Compound Name | 5-methyl-2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 23631076 |
| Molecular Formula | C16H20BNO2S |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 5-methyl-2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
| SMILES | Cc1sc(-c2ccccc2)nc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H20BNO2S/c1-11-13(17-19-15(2,3)16(4,5)20-17)18-14(21-11)12-9-7-6-8-10-12/h6-10H,1-5H3 |
| InChIKey | VXHPMPFSZKUXQN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|