C26H50O5Si — CID 23631118
(2R,5E)-2-[(2S,5S)-5-[(2R)-2-hydroxy-1-(2-trimethylsilylethoxymethoxy)propan-2-yl]oxolan-2-yl]-6,10-dimethylundeca-5,9-dien-2-ol (PubChem CID 23631118) has the molecular formula C26H50O5Si and a molecular weight of 470.77 g/mol. Its IUPAC name is (2R,5E)-2-[(2S,5S)-5-[(2R)-2-hydroxy-1-(2-trimethylsilylethoxymethoxy)propan-2-yl]oxolan-2-yl]-6,10-dimethylundeca-5,9-dien-2-ol.
| Compound Name | (2R,5E)-2-[(2S,5S)-5-[(2R)-2-hydroxy-1-(2-trimethylsilylethoxymethoxy)propan-2-yl]oxolan-2-yl]-6,10-dimethylundeca-5,9-dien-2-ol |
|---|---|
| PubChem CID | 23631118 |
| Molecular Formula | C26H50O5Si |
| Molecular Weight | 470.77 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | (2R,5E)-2-[(2S,5S)-5-[(2R)-2-hydroxy-1-(2-trimethylsilylethoxymethoxy)propan-2-yl]oxolan-2-yl]-6,10-dimethylundeca-5,9-dien-2-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC[C@@](C)(O)[C@@H]1CC[C@@H]([C@](C)(O)COCOCC[Si](C)(C)C)O1 |
| InChI | InChI=1S/C26H50O5Si/c1-21(2)11-9-12-22(3)13-10-16-25(4,27)23-14-15-24(31-23)26(5,28)19-30-20-29-17-18-32(6,7)8/h11,13,23-24,27-28H,9-10,12,14-20H2,1-8H3/b22-13+/t23-,24-,25+,26+/m0/s1 |
| InChIKey | VJNMCFGNFSNAOE-SQSKPHHUSA-N |
| XLogP | 5.84 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.77 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|