C26H50O7Si — CID 23631119
(2R)-4-[(2R,3R)-3-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]-2-[(2S,5S)-5-[(2R)-2-hydroxy-1-(2-trimethylsilylethoxymethoxy)propan-2-yl]oxolan-2-yl]butan-2-ol (PubChem CID 23631119) has the molecular formula C26H50O7Si and a molecular weight of 502.77 g/mol. Its IUPAC name is (2R)-4-[(2R,3R)-3-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]-2-[(2S,5S)-5-[(2R)-2-hydroxy-1-(2-trimethylsilylethoxymethoxy)propan-2-yl]oxolan-2-yl]butan-2-ol.
| Compound Name | (2R)-4-[(2R,3R)-3-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]-2-[(2S,5S)-5-[(2R)-2-hydroxy-1-(2-trimethylsilylethoxymethoxy)propan-2-yl]oxolan-2-yl]butan-2-ol |
|---|---|
| PubChem CID | 23631119 |
| Molecular Formula | C26H50O7Si |
| Molecular Weight | 502.77 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | (2R)-4-[(2R,3R)-3-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]-2-[(2S,5S)-5-[(2R)-2-hydroxy-1-(2-trimethylsilylethoxymethoxy)propan-2-yl]oxolan-2-yl]butan-2-ol |
| SMILES | CC1(C)O[C@@H]1CC[C@@]1(C)O[C@@H]1CC[C@@](C)(O)[C@@H]1CC[C@@H]([C@](C)(O)COCOCC[Si](C)(C)C)O1 |
| InChI | InChI=1S/C26H50O7Si/c1-23(2)19(32-23)12-14-26(5)22(33-26)11-13-24(3,27)20-9-10-21(31-20)25(4,28)17-30-18-29-15-16-34(6,7)8/h19-22,27-28H,9-18H2,1-8H3/t19-,20+,21+,22-,24-,25-,26-/m1/s1 |
| InChIKey | OAEATLAASOGIGC-ZRQYGHIPSA-N |
| XLogP | 4.26 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.77 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|