C27H31N3O4 — CID 23631275
ethyl (1R,3aR,4aS,8aS,9S,9aS)-1-methyl-3-oxo-9-[(E)-2-(5-pyridin-2-yl-2-pyridinyl)ethenyl]-1,3a,4,4a,5,7,8,8a,9,9a-decahydrofuro[3,4-g]isoquinoline-6-carboxylate (PubChem CID 23631275) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is ethyl (1R,3aR,4aS,8aS,9S,9aS)-1-methyl-3-oxo-9-[(E)-2-(5-pyridin-2-yl-2-pyridinyl)ethenyl]-1,3a,4,4a,5,7,8,8a,9,9a-decahydrofuro[3,4-g]isoquinoline-6-carboxylate.
| Compound Name | ethyl (1R,3aR,4aS,8aS,9S,9aS)-1-methyl-3-oxo-9-[(E)-2-(5-pyridin-2-yl-2-pyridinyl)ethenyl]-1,3a,4,4a,5,7,8,8a,9,9a-decahydrofuro[3,4-g]isoquinoline-6-carboxylate |
|---|---|
| PubChem CID | 23631275 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | ethyl (1R,3aR,4aS,8aS,9S,9aS)-1-methyl-3-oxo-9-[(E)-2-(5-pyridin-2-yl-2-pyridinyl)ethenyl]-1,3a,4,4a,5,7,8,8a,9,9a-decahydrofuro[3,4-g]isoquinoline-6-carboxylate |
| SMILES | CCOC(=O)N1CC[C@@H]2[C@H](C[C@H]3C(=O)O[C@H](C)[C@H]3[C@H]2/C=C/c2ccc(-c3ccccn3)cn2)C1 |
| InChI | InChI=1S/C27H31N3O4/c1-3-33-27(32)30-13-11-21-19(16-30)14-23-25(17(2)34-26(23)31)22(21)10-9-20-8-7-18(15-29-20)24-6-4-5-12-28-24/h4-10,12,15,17,19,21-23,25H,3,11,13-14,16H2,1-2H3/b10-9+/t17-,19-,21-,22+,23-,25+/m1/s1 |
| InChIKey | PWLHMMSJOIYUHW-XHLUTMRQSA-N |
| XLogP | 4.45 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |