C18H33NO3 — CID 23631692
[(4Z,6S)-7-hydroxy-2,6,7-trimethylocta-2,4-dien-4-yl] N,N-di(propan-2-yl)carbamate (PubChem CID 23631692) has the molecular formula C18H33NO3 and a molecular weight of 311.47 g/mol. Its IUPAC name is [(4Z,6S)-7-hydroxy-2,6,7-trimethylocta-2,4-dien-4-yl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(4Z,6S)-7-hydroxy-2,6,7-trimethylocta-2,4-dien-4-yl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 23631692 |
| Molecular Formula | C18H33NO3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.25 |
| IUPAC Name | [(4Z,6S)-7-hydroxy-2,6,7-trimethylocta-2,4-dien-4-yl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)=C/C(=C/[C@H](C)C(C)(C)O)OC(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C18H33NO3/c1-12(2)10-16(11-15(7)18(8,9)21)22-17(20)19(13(3)4)14(5)6/h10-11,13-15,21H,1-9H3/b16-11-/t15-/m0/s1 |
| InChIKey | NZPUKBDLGDFPQX-CNYBTUBUSA-N |
| XLogP | 4.50 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|