C19H16FN3O — CID 23632686
2-(2-fluoroanilino)-N-(3-methylphenyl)pyridine-3-carboxamide (PubChem CID 23632686) has the molecular formula C19H16FN3O and a molecular weight of 321.36 g/mol. Its IUPAC name is 2-(2-fluoroanilino)-N-(3-methylphenyl)pyridine-3-carboxamide.
| Compound Name | 2-(2-fluoroanilino)-N-(3-methylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 23632686 |
| Molecular Formula | C19H16FN3O |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 2-(2-fluoroanilino)-N-(3-methylphenyl)pyridine-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cccnc2Nc2ccccc2F)c1 |
| InChI | InChI=1S/C19H16FN3O/c1-13-6-4-7-14(12-13)22-19(24)15-8-5-11-21-18(15)23-17-10-3-2-9-16(17)20/h2-12H,1H3,(H,21,23)(H,22,24) |
| InChIKey | OCTSZLAZVSCSJG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |