C19H13F4N3O2 — CID 23632897
2-(3-fluoroanilino)-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide (PubChem CID 23632897) has the molecular formula C19H13F4N3O2 and a molecular weight of 391.32 g/mol. Its IUPAC name is 2-(3-fluoroanilino)-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide.
| Compound Name | 2-(3-fluoroanilino)-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 23632897 |
| Molecular Formula | C19H13F4N3O2 |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 2-(3-fluoroanilino)-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)c1cccnc1Nc1cccc(F)c1 |
| InChI | InChI=1S/C19H13F4N3O2/c20-12-3-1-4-14(11-12)25-17-16(5-2-10-24-17)18(27)26-13-6-8-15(9-7-13)28-19(21,22)23/h1-11H,(H,24,25)(H,26,27) |
| InChIKey | JGJCGPSAEHOFCY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |