C16H18F2N4O2 — CID 23633410
(3S)-3-[(4-aminopiperidin-1-yl)methyl]-5,10-difluoro-3-hydroxy-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one (PubChem CID 23633410) has the molecular formula C16H18F2N4O2 and a molecular weight of 336.34 g/mol. Its IUPAC name is (3S)-3-[(4-aminopiperidin-1-yl)methyl]-5,10-difluoro-3-hydroxy-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one.
| Compound Name | (3S)-3-[(4-aminopiperidin-1-yl)methyl]-5,10-difluoro-3-hydroxy-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one |
|---|---|
| PubChem CID | 23633410 |
| Molecular Formula | C16H18F2N4O2 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (3S)-3-[(4-aminopiperidin-1-yl)methyl]-5,10-difluoro-3-hydroxy-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one |
| SMILES | NC1CCN(C[C@]2(O)Cn3c(=O)c(F)cc4ncc(F)c2c43)CC1 |
| InChI | InChI=1S/C16H18F2N4O2/c17-10-5-12-14-13(11(18)6-20-12)16(24,8-22(14)15(10)23)7-21-3-1-9(19)2-4-21/h5-6,9,24H,1-4,7-8,19H2/t16-/m0/s1 |
| InChIKey | UXAFBNIKQNQNSK-INIZCTEOSA-N |
| XLogP | 0.30 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |