C26H25N7O — CID 23633553
5-but-2-ynyl-6-(1,4-diazepan-1-yl)-3-(isoquinolin-1-ylmethyl)-4-oxopyrrolo[3,2-d]pyrimidine-7-carbonitrile (PubChem CID 23633553) has the molecular formula C26H25N7O and a molecular weight of 451.53 g/mol. Its IUPAC name is 5-but-2-ynyl-6-(1,4-diazepan-1-yl)-3-(isoquinolin-1-ylmethyl)-4-oxopyrrolo[3,2-d]pyrimidine-7-carbonitrile.
| Compound Name | 5-but-2-ynyl-6-(1,4-diazepan-1-yl)-3-(isoquinolin-1-ylmethyl)-4-oxopyrrolo[3,2-d]pyrimidine-7-carbonitrile |
|---|---|
| PubChem CID | 23633553 |
| Molecular Formula | C26H25N7O |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 5-but-2-ynyl-6-(1,4-diazepan-1-yl)-3-(isoquinolin-1-ylmethyl)-4-oxopyrrolo[3,2-d]pyrimidine-7-carbonitrile |
| SMILES | CC#CCn1c(N2CCCNCC2)c(C#N)c2ncn(Cc3nccc4ccccc34)c(=O)c21 |
| InChI | InChI=1S/C26H25N7O/c1-2-3-14-33-24-23(21(16-27)25(33)31-13-6-10-28-12-15-31)30-18-32(26(24)34)17-22-20-8-5-4-7-19(20)9-11-29-22/h4-5,7-9,11,18,28H,6,10,12-15,17H2,1H3 |
| InChIKey | IODVMCDOTSDYIF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 91.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|