C26H26FN5O2 — CID 23633758
(3S)-5-fluoro-3-hydroxy-3-[[4-(quinolin-3-ylmethylamino)piperidin-1-yl]methyl]-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one (PubChem CID 23633758) has the molecular formula C26H26FN5O2 and a molecular weight of 459.53 g/mol. Its IUPAC name is (3S)-5-fluoro-3-hydroxy-3-[[4-(quinolin-3-ylmethylamino)piperidin-1-yl]methyl]-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one.
| Compound Name | (3S)-5-fluoro-3-hydroxy-3-[[4-(quinolin-3-ylmethylamino)piperidin-1-yl]methyl]-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one |
|---|---|
| PubChem CID | 23633758 |
| Molecular Formula | C26H26FN5O2 |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | (3S)-5-fluoro-3-hydroxy-3-[[4-(quinolin-3-ylmethylamino)piperidin-1-yl]methyl]-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one |
| SMILES | O=c1ccc2ncc(F)c3c2n1C[C@@]3(O)CN1CCC(NCc2cnc3ccccc3c2)CC1 |
| InChI | InChI=1S/C26H26FN5O2/c27-20-14-30-22-5-6-23(33)32-16-26(34,24(20)25(22)32)15-31-9-7-19(8-10-31)28-12-17-11-18-3-1-2-4-21(18)29-13-17/h1-6,11,13-14,19,28,34H,7-10,12,15-16H2/t26-/m0/s1 |
| InChIKey | MIMABBMJQCWMPA-SANMLTNESA-N |
| XLogP | 2.54 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |