C25H25FN6O2 — CID 23633762
(3S)-5-fluoro-3-hydroxy-3-[[4-(quinoxalin-6-ylmethylamino)piperidin-1-yl]methyl]-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one (PubChem CID 23633762) has the molecular formula C25H25FN6O2 and a molecular weight of 460.51 g/mol. Its IUPAC name is (3S)-5-fluoro-3-hydroxy-3-[[4-(quinoxalin-6-ylmethylamino)piperidin-1-yl]methyl]-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one.
| Compound Name | (3S)-5-fluoro-3-hydroxy-3-[[4-(quinoxalin-6-ylmethylamino)piperidin-1-yl]methyl]-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one |
|---|---|
| PubChem CID | 23633762 |
| Molecular Formula | C25H25FN6O2 |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | (3S)-5-fluoro-3-hydroxy-3-[[4-(quinoxalin-6-ylmethylamino)piperidin-1-yl]methyl]-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one |
| SMILES | O=c1ccc2ncc(F)c3c2n1C[C@@]3(O)CN1CCC(NCc2ccc3nccnc3c2)CC1 |
| InChI | InChI=1S/C25H25FN6O2/c26-18-13-30-20-3-4-22(33)32-15-25(34,23(18)24(20)32)14-31-9-5-17(6-10-31)29-12-16-1-2-19-21(11-16)28-8-7-27-19/h1-4,7-8,11,13,17,29,34H,5-6,9-10,12,14-15H2/t25-/m0/s1 |
| InChIKey | GCVGUPDBZMJZQY-VWLOTQADSA-N |
| XLogP | 1.93 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |