C28H29F3N4O2 — CID 23633805
(E)-1-[4-[2-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)piperidin-1-yl]acetyl]piperidin-1-yl]-3-(3,4,5-trifluorophenyl)prop-2-en-1-one (PubChem CID 23633805) has the molecular formula C28H29F3N4O2 and a molecular weight of 510.56 g/mol. Its IUPAC name is (E)-1-[4-[2-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)piperidin-1-yl]acetyl]piperidin-1-yl]-3-(3,4,5-trifluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[2-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)piperidin-1-yl]acetyl]piperidin-1-yl]-3-(3,4,5-trifluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 23633805 |
| Molecular Formula | C28H29F3N4O2 |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | (E)-1-[4-[2-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)piperidin-1-yl]acetyl]piperidin-1-yl]-3-(3,4,5-trifluorophenyl)prop-2-en-1-one |
| SMILES | O=C(CN1CCC(c2c[nH]c3ncccc23)CC1)C1CCN(C(=O)/C=C/c2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C28H29F3N4O2/c29-23-14-18(15-24(30)27(23)31)3-4-26(37)35-12-7-20(8-13-35)25(36)17-34-10-5-19(6-11-34)22-16-33-28-21(22)2-1-9-32-28/h1-4,9,14-16,19-20H,5-8,10-13,17H2,(H,32,33)/b4-3+ |
| InChIKey | NIGZOYPMQAGRET-ONEGZZNKSA-N |
| XLogP | 4.68 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|