About 4-phenyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one
4-phenyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 2363388) has the molecular formula C15H10N4O
and a molecular weight of 262.27 g/mol. Its IUPAC name is 4-phenyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
Molecular Properties
| Compound Name | 4-phenyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| PubChem CID | 2363388 |
| Molecular Formula | C15H10N4O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 4-phenyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | O=c1c2ccccc2n2cnnc2n1-c1ccccc1 |
| InChI | InChI=1S/C15H10N4O/c20-14-12-8-4-5-9-13(12)18-10-16-17-15(18)19(14)11-6-2-1-3-7-11/h1-10H |
| InChIKey | ABOYWWJAAQGMMT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-phenyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one?
The IUPAC name of 4-phenyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one (CID 2363388) is 4-phenyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
What is the SMILES notation for 4-phenyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one?
The canonical SMILES for 4-phenyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one is O=c1c2ccccc2n2cnnc2n1-c1ccccc1.
What is the InChIKey of 4-phenyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one?
The InChIKey is ABOYWWJAAQGMMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N4O/c20-14-12-8-4-5-9-13(12)18-10-16-17-15(18)19(14)11-6-2-1-3-7-11/h1-10H.
What are the key properties of 4-phenyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one?
4-phenyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one has a molecular weight of 262.27 g/mol, XLogP of 2.03, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one is sourced from PubChem (CID 2363388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).