C16H18F2N4O — CID 23634204
3-[(4-aminopiperidin-1-yl)methyl]-3,5-difluoro-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one (PubChem CID 23634204) has the molecular formula C16H18F2N4O and a molecular weight of 320.34 g/mol. Its IUPAC name is 3-[(4-aminopiperidin-1-yl)methyl]-3,5-difluoro-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one.
| Compound Name | 3-[(4-aminopiperidin-1-yl)methyl]-3,5-difluoro-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one |
|---|---|
| PubChem CID | 23634204 |
| Molecular Formula | C16H18F2N4O |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 3-[(4-aminopiperidin-1-yl)methyl]-3,5-difluoro-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one |
| SMILES | NC1CCN(CC2(F)Cn3c(=O)ccc4ncc(F)c2c43)CC1 |
| InChI | InChI=1S/C16H18F2N4O/c17-11-7-20-12-1-2-13(23)22-9-16(18,14(11)15(12)22)8-21-5-3-10(19)4-6-21/h1-2,7,10H,3-6,8-9,19H2 |
| InChIKey | XQYKEFSRDJJFOZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |