C13H21NO — CID 23634565
(1S,4R,8R)-8-butyl-7-azatricyclo[5.3.0.04,8]decan-3-one (PubChem CID 23634565) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (1S,4R,8R)-8-butyl-7-azatricyclo[5.3.0.04,8]decan-3-one.
| Compound Name | (1S,4R,8R)-8-butyl-7-azatricyclo[5.3.0.04,8]decan-3-one |
|---|---|
| PubChem CID | 23634565 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (1S,4R,8R)-8-butyl-7-azatricyclo[5.3.0.04,8]decan-3-one |
| SMILES | CCCC[C@@]12CC[C@H]3CC(=O)[C@@H]1CCN32 |
| InChI | InChI=1S/C13H21NO/c1-2-3-6-13-7-4-10-9-12(15)11(13)5-8-14(10)13/h10-11H,2-9H2,1H3/t10-,11-,13+/m0/s1 |
| InChIKey | ANEDSGFPDXAFRN-GMXVVIOVSA-N |
| XLogP | 2.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |