C29H48N2O4 — CID 23634634
N-[(1R,6S,7S,8R,11R,12S,14R,15S,16R)-15-[(1S)-1-(dimethylamino)ethyl]-14-hydroxy-7-(hydroxymethyl)-7,12,16-trimethyl-18-oxo-6-tetracyclo[9.7.0.03,8.012,16]octadec-3-enyl]propanamide (PubChem CID 23634634) has the molecular formula C29H48N2O4 and a molecular weight of 488.71 g/mol. Its IUPAC name is N-[(1R,6S,7S,8R,11R,12S,14R,15S,16R)-15-[(1S)-1-(dimethylamino)ethyl]-14-hydroxy-7-(hydroxymethyl)-7,12,16-trimethyl-18-oxo-6-tetracyclo[9.7.0.03,8.012,16]octadec-3-enyl]propanamide.
| Compound Name | N-[(1R,6S,7S,8R,11R,12S,14R,15S,16R)-15-[(1S)-1-(dimethylamino)ethyl]-14-hydroxy-7-(hydroxymethyl)-7,12,16-trimethyl-18-oxo-6-tetracyclo[9.7.0.03,8.012,16]octadec-3-enyl]propanamide |
|---|---|
| PubChem CID | 23634634 |
| Molecular Formula | C29H48N2O4 |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.36 |
| IUPAC Name | N-[(1R,6S,7S,8R,11R,12S,14R,15S,16R)-15-[(1S)-1-(dimethylamino)ethyl]-14-hydroxy-7-(hydroxymethyl)-7,12,16-trimethyl-18-oxo-6-tetracyclo[9.7.0.03,8.012,16]octadec-3-enyl]propanamide |
| SMILES | CCC(=O)N[C@H]1CC=C2C[C@H]3C(=O)C[C@]4(C)[C@@H]([C@H](C)N(C)C)[C@H](O)C[C@@]4(C)[C@@H]3CC[C@H]2[C@]1(C)CO |
| InChI | InChI=1S/C29H48N2O4/c1-8-25(35)30-24-12-9-18-13-19-21(11-10-20(18)27(24,3)16-32)28(4)15-23(34)26(17(2)31(6)7)29(28,5)14-22(19)33/h9,17,19-21,23-24,26,32,34H,8,10-16H2,1-7H3,(H,30,35)/t17-,19+,20+,21+,23+,24-,26-,27-,28-,29+/m0/s1 |
| InChIKey | XNUKIPDNVJOIIQ-LIQNAGFCSA-N |
| XLogP | 3.56 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|