About S-(4-methylphenyl) (4S,5S)-5-methyl-2-oxo-1,3-dioxolane-4-carbothioate
S-(4-methylphenyl) (4S,5S)-5-methyl-2-oxo-1,3-dioxolane-4-carbothioate (PubChem CID 23634812) has the molecular formula C12H12O4S
and a molecular weight of 252.29 g/mol. Its IUPAC name is S-(4-methylphenyl) (4S,5S)-5-methyl-2-oxo-1,3-dioxolane-4-carbothioate.
Molecular Properties
| Compound Name | S-(4-methylphenyl) (4S,5S)-5-methyl-2-oxo-1,3-dioxolane-4-carbothioate |
| PubChem CID | 23634812 |
| Molecular Formula | C12H12O4S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | S-(4-methylphenyl) (4S,5S)-5-methyl-2-oxo-1,3-dioxolane-4-carbothioate |
| SMILES | Cc1ccc(SC(=O)[C@H]2OC(=O)O[C@H]2C)cc1 |
| InChI | InChI=1S/C12H12O4S/c1-7-3-5-9(6-4-7)17-11(13)10-8(2)15-12(14)16-10/h3-6,8,10H,1-2H3/t8-,10-/m0/s1 |
| InChIKey | RWENIOWUDHSKQQ-WPRPVWTQSA-N |
| XLogP | 2.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-methylphenyl) (4S,5S)-5-methyl-2-oxo-1,3-dioxolane-4-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-methylphenyl) (4S,5S)-5-methyl-2-oxo-1,3-dioxolane-4-carbothioate?
The IUPAC name of S-(4-methylphenyl) (4S,5S)-5-methyl-2-oxo-1,3-dioxolane-4-carbothioate (CID 23634812) is S-(4-methylphenyl) (4S,5S)-5-methyl-2-oxo-1,3-dioxolane-4-carbothioate.
What is the SMILES notation for S-(4-methylphenyl) (4S,5S)-5-methyl-2-oxo-1,3-dioxolane-4-carbothioate?
The canonical SMILES for S-(4-methylphenyl) (4S,5S)-5-methyl-2-oxo-1,3-dioxolane-4-carbothioate is Cc1ccc(SC(=O)[C@H]2OC(=O)O[C@H]2C)cc1.
What is the InChIKey of S-(4-methylphenyl) (4S,5S)-5-methyl-2-oxo-1,3-dioxolane-4-carbothioate?
The InChIKey is RWENIOWUDHSKQQ-WPRPVWTQSA-N. The full InChI is InChI=1S/C12H12O4S/c1-7-3-5-9(6-4-7)17-11(13)10-8(2)15-12(14)16-10/h3-6,8,10H,1-2H3/t8-,10-/m0/s1.
What are the key properties of S-(4-methylphenyl) (4S,5S)-5-methyl-2-oxo-1,3-dioxolane-4-carbothioate?
S-(4-methylphenyl) (4S,5S)-5-methyl-2-oxo-1,3-dioxolane-4-carbothioate has a molecular weight of 252.29 g/mol, XLogP of 2.54, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-methylphenyl) (4S,5S)-5-methyl-2-oxo-1,3-dioxolane-4-carbothioate is sourced from PubChem (CID 23634812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).