C14H16Cl2N4 — CID 23634975
2-(2,4-dichlorophenyl)-N-prop-2-enyl-3-(1,2,4-triazol-1-yl)propan-1-amine (PubChem CID 23634975) has the molecular formula C14H16Cl2N4 and a molecular weight of 311.22 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-prop-2-enyl-3-(1,2,4-triazol-1-yl)propan-1-amine.
| Compound Name | 2-(2,4-dichlorophenyl)-N-prop-2-enyl-3-(1,2,4-triazol-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 23634975 |
| Molecular Formula | C14H16Cl2N4 |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-prop-2-enyl-3-(1,2,4-triazol-1-yl)propan-1-amine |
| SMILES | C=CCNCC(Cn1cncn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H16Cl2N4/c1-2-5-17-7-11(8-20-10-18-9-19-20)13-4-3-12(15)6-14(13)16/h2-4,6,9-11,17H,1,5,7-8H2 |
| InChIKey | PPRLJIWAZGQDPF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|