C20H20Cl2N4 — CID 23634976
2-(2,4-dichlorophenyl)-N-[(E)-3-phenylprop-2-enyl]-3-(1,2,4-triazol-1-yl)propan-1-amine (PubChem CID 23634976) has the molecular formula C20H20Cl2N4 and a molecular weight of 387.31 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-[(E)-3-phenylprop-2-enyl]-3-(1,2,4-triazol-1-yl)propan-1-amine.
| Compound Name | 2-(2,4-dichlorophenyl)-N-[(E)-3-phenylprop-2-enyl]-3-(1,2,4-triazol-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 23634976 |
| Molecular Formula | C20H20Cl2N4 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-[(E)-3-phenylprop-2-enyl]-3-(1,2,4-triazol-1-yl)propan-1-amine |
| SMILES | Clc1ccc(C(CNC/C=C/c2ccccc2)Cn2cncn2)c(Cl)c1 |
| InChI | InChI=1S/C20H20Cl2N4/c21-18-8-9-19(20(22)11-18)17(13-26-15-24-14-25-26)12-23-10-4-7-16-5-2-1-3-6-16/h1-9,11,14-15,17,23H,10,12-13H2/b7-4+ |
| InChIKey | ADBXGEMXVPYOFX-QPJJXVBHSA-N |
| XLogP | 4.67 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|