C17H20Cl2N4 — CID 23634977
2-(2,4-dichlorophenyl)-N,N-bis(prop-2-enyl)-3-(1,2,4-triazol-1-yl)propan-1-amine (PubChem CID 23634977) has the molecular formula C17H20Cl2N4 and a molecular weight of 351.28 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N,N-bis(prop-2-enyl)-3-(1,2,4-triazol-1-yl)propan-1-amine.
| Compound Name | 2-(2,4-dichlorophenyl)-N,N-bis(prop-2-enyl)-3-(1,2,4-triazol-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 23634977 |
| Molecular Formula | C17H20Cl2N4 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N,N-bis(prop-2-enyl)-3-(1,2,4-triazol-1-yl)propan-1-amine |
| SMILES | C=CCN(CC=C)CC(Cn1cncn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H20Cl2N4/c1-3-7-22(8-4-2)10-14(11-23-13-20-12-21-23)16-6-5-15(18)9-17(16)19/h3-6,9,12-14H,1-2,7-8,10-11H2 |
| InChIKey | IHRGMQHAUKJNKI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|