C32H50N2O5 — CID 23635002
[(1R,3R,6S,7S,8R,11S,12S,14R,15S,16R)-15-[(1S)-1-(dimethylamino)ethyl]-7-formyl-7,12,16-trimethyl-6-(2-methylpropanoylamino)-18-oxo-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate (PubChem CID 23635002) has the molecular formula C32H50N2O5 and a molecular weight of 542.76 g/mol. Its IUPAC name is [(1R,3R,6S,7S,8R,11S,12S,14R,15S,16R)-15-[(1S)-1-(dimethylamino)ethyl]-7-formyl-7,12,16-trimethyl-6-(2-methylpropanoylamino)-18-oxo-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate.
| Compound Name | [(1R,3R,6S,7S,8R,11S,12S,14R,15S,16R)-15-[(1S)-1-(dimethylamino)ethyl]-7-formyl-7,12,16-trimethyl-6-(2-methylpropanoylamino)-18-oxo-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate |
|---|---|
| PubChem CID | 23635002 |
| Molecular Formula | C32H50N2O5 |
| Molecular Weight | 542.76 g/mol |
| Exact Mass | 542.37 |
| IUPAC Name | [(1R,3R,6S,7S,8R,11S,12S,14R,15S,16R)-15-[(1S)-1-(dimethylamino)ethyl]-7-formyl-7,12,16-trimethyl-6-(2-methylpropanoylamino)-18-oxo-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@]2(C)[C@@H]3CC[C@H]4[C@](C)(C=O)[C@@H](NC(=O)C(C)C)CC[C@@]45C[C@@]35C(=O)C[C@]2(C)[C@H]1[C@H](C)N(C)C |
| InChI | InChI=1S/C32H50N2O5/c1-18(2)27(38)33-24-12-13-31-16-32(31)23(11-10-22(31)28(24,5)17-35)29(6)14-21(39-20(4)36)26(19(3)34(8)9)30(29,7)15-25(32)37/h17-19,21-24,26H,10-16H2,1-9H3,(H,33,38)/t19-,21+,22-,23-,24-,26-,28-,29-,30+,31+,32-/m0/s1 |
| InChIKey | BAOAQBCMDVDOOQ-MRFVJFJHSA-N |
| XLogP | 4.42 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.76 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|