C19H32BrNO — CID 23635116
6-(nonylamino)-5,6,7,8-tetrahydronaphthalen-1-ol;hydrobromide (PubChem CID 23635116) has the molecular formula C19H32BrNO and a molecular weight of 370.38 g/mol. Its IUPAC name is 6-(nonylamino)-5,6,7,8-tetrahydronaphthalen-1-ol;hydrobromide.
| Compound Name | 6-(nonylamino)-5,6,7,8-tetrahydronaphthalen-1-ol;hydrobromide |
|---|---|
| PubChem CID | 23635116 |
| Molecular Formula | C19H32BrNO |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 6-(nonylamino)-5,6,7,8-tetrahydronaphthalen-1-ol;hydrobromide |
| SMILES | Br.CCCCCCCCCNC1CCc2c(O)cccc2C1 |
| InChI | InChI=1S/C19H31NO.BrH/c1-2-3-4-5-6-7-8-14-20-17-12-13-18-16(15-17)10-9-11-19(18)21;/h9-11,17,20-21H,2-8,12-15H2,1H3;1H |
| InChIKey | FDZBNWGARFFYMZ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|