C14H10F2O2 — CID 23635452
(9R,10R)-3,6-difluoro-9,10-dihydrophenanthrene-9,10-diol (PubChem CID 23635452) has the molecular formula C14H10F2O2 and a molecular weight of 248.23 g/mol. Its IUPAC name is (9R,10R)-3,6-difluoro-9,10-dihydrophenanthrene-9,10-diol.
| Compound Name | (9R,10R)-3,6-difluoro-9,10-dihydrophenanthrene-9,10-diol |
|---|---|
| PubChem CID | 23635452 |
| Molecular Formula | C14H10F2O2 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | (9R,10R)-3,6-difluoro-9,10-dihydrophenanthrene-9,10-diol |
| SMILES | O[C@@H]1c2ccc(F)cc2-c2cc(F)ccc2[C@H]1O |
| InChI | InChI=1S/C14H10F2O2/c15-7-1-3-9-11(5-7)12-6-8(16)2-4-10(12)14(18)13(9)17/h1-6,13-14,17-18H/t13-,14-/m1/s1 |
| InChIKey | NXJVFVVRZMLTQQ-ZIAGYGMSSA-N |
| XLogP | 2.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |