C29H46N2O3 — CID 23635496
(3R,6R,7S,8R,10S,11R,14R,15S,20S)-8-hydroxy-6,10,15-trimethyl-7-[(1S)-1-(methylamino)ethyl]-18-propan-2-yl-17-oxa-19-azapentacyclo[12.8.0.03,11.06,10.015,20]docosa-1(22),18-dien-4-one (PubChem CID 23635496) has the molecular formula C29H46N2O3 and a molecular weight of 470.70 g/mol. Its IUPAC name is (3R,6R,7S,8R,10S,11R,14R,15S,20S)-8-hydroxy-6,10,15-trimethyl-7-[(1S)-1-(methylamino)ethyl]-18-propan-2-yl-17-oxa-19-azapentacyclo[12.8.0.03,11.06,10.015,20]docosa-1(22),18-dien-4-one.
| Compound Name | (3R,6R,7S,8R,10S,11R,14R,15S,20S)-8-hydroxy-6,10,15-trimethyl-7-[(1S)-1-(methylamino)ethyl]-18-propan-2-yl-17-oxa-19-azapentacyclo[12.8.0.03,11.06,10.015,20]docosa-1(22),18-dien-4-one |
|---|---|
| PubChem CID | 23635496 |
| Molecular Formula | C29H46N2O3 |
| Molecular Weight | 470.70 g/mol |
| Exact Mass | 470.35 |
| IUPAC Name | (3R,6R,7S,8R,10S,11R,14R,15S,20S)-8-hydroxy-6,10,15-trimethyl-7-[(1S)-1-(methylamino)ethyl]-18-propan-2-yl-17-oxa-19-azapentacyclo[12.8.0.03,11.06,10.015,20]docosa-1(22),18-dien-4-one |
| SMILES | CN[C@@H](C)[C@H]1[C@H](O)C[C@@]2(C)[C@@H]3CC[C@@H]4C(=CC[C@@H]5N=C(C(C)C)OC[C@]54C)C[C@H]3C(=O)C[C@]12C |
| InChI | InChI=1S/C29H46N2O3/c1-16(2)26-31-24-11-8-18-12-19-21(10-9-20(18)27(24,4)15-34-26)28(5)14-23(33)25(17(3)30-7)29(28,6)13-22(19)32/h8,16-17,19-21,23-25,30,33H,9-15H2,1-7H3/t17-,19+,20+,21+,23+,24-,25-,27-,28-,29+/m0/s1 |
| InChIKey | UQAHSQZJTMTZHV-NAPGQHCVSA-N |
| XLogP | 4.78 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.70 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|