About [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-(2,4-dichlorophenyl)acetate
[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-(2,4-dichlorophenyl)acetate (PubChem CID 2363554) has the molecular formula C18H17Cl2NO4
and a molecular weight of 382.24 g/mol. Its IUPAC name is [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-(2,4-dichlorophenyl)acetate.
Molecular Properties
| Compound Name | [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-(2,4-dichlorophenyl)acetate |
| PubChem CID | 2363554 |
| Molecular Formula | C18H17Cl2NO4 |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-(2,4-dichlorophenyl)acetate |
| SMILES | COc1ccc(CNC(=O)COC(=O)Cc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H17Cl2NO4/c1-24-15-6-2-12(3-7-15)10-21-17(22)11-25-18(23)8-13-4-5-14(19)9-16(13)20/h2-7,9H,8,10-11H2,1H3,(H,21,22) |
| InChIKey | YYOCLLREEJNSSS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-(2,4-dichlorophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-(2,4-dichlorophenyl)acetate?
The IUPAC name of [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-(2,4-dichlorophenyl)acetate (CID 2363554) is [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-(2,4-dichlorophenyl)acetate.
What is the SMILES notation for [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-(2,4-dichlorophenyl)acetate?
The canonical SMILES for [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-(2,4-dichlorophenyl)acetate is COc1ccc(CNC(=O)COC(=O)Cc2ccc(Cl)cc2Cl)cc1.
What is the InChIKey of [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-(2,4-dichlorophenyl)acetate?
The InChIKey is YYOCLLREEJNSSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17Cl2NO4/c1-24-15-6-2-12(3-7-15)10-21-17(22)11-25-18(23)8-13-4-5-14(19)9-16(13)20/h2-7,9H,8,10-11H2,1H3,(H,21,22).
What are the key properties of [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-(2,4-dichlorophenyl)acetate?
[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-(2,4-dichlorophenyl)acetate has a molecular weight of 382.24 g/mol, XLogP of 3.40, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-(2,4-dichlorophenyl)acetate is sourced from PubChem (CID 2363554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).