C15H18O3 — CID 23635550
(3R,3aS,6S,6aR,9bS)-3,6,9-trimethyl-3,3a,6,6a,7,9b-hexahydroazuleno[4,5-b]furan-2,8-dione (PubChem CID 23635550) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (3R,3aS,6S,6aR,9bS)-3,6,9-trimethyl-3,3a,6,6a,7,9b-hexahydroazuleno[4,5-b]furan-2,8-dione.
| Compound Name | (3R,3aS,6S,6aR,9bS)-3,6,9-trimethyl-3,3a,6,6a,7,9b-hexahydroazuleno[4,5-b]furan-2,8-dione |
|---|---|
| PubChem CID | 23635550 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (3R,3aS,6S,6aR,9bS)-3,6,9-trimethyl-3,3a,6,6a,7,9b-hexahydroazuleno[4,5-b]furan-2,8-dione |
| SMILES | CC1=C2[C@H]3OC(=O)[C@H](C)[C@@H]3C=C[C@H](C)[C@H]2CC1=O |
| InChI | InChI=1S/C15H18O3/c1-7-4-5-10-8(2)15(17)18-14(10)13-9(3)12(16)6-11(7)13/h4-5,7-8,10-11,14H,6H2,1-3H3/t7-,8+,10-,11+,14-/m0/s1 |
| InChIKey | UZIPALMDIBZJCH-FATDGTKTSA-N |
| XLogP | 2.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|