About 2-hydroxy-3,3-dimethyl-1H-isoindole
2-hydroxy-3,3-dimethyl-1H-isoindole (PubChem CID 23635567) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-hydroxy-3,3-dimethyl-1H-isoindole.
Molecular Properties
| Compound Name | 2-hydroxy-3,3-dimethyl-1H-isoindole |
| PubChem CID | 23635567 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 2-hydroxy-3,3-dimethyl-1H-isoindole |
| SMILES | CC1(C)c2ccccc2CN1O |
| InChI | InChI=1S/C10H13NO/c1-10(2)9-6-4-3-5-8(9)7-11(10)12/h3-6,12H,7H2,1-2H3 |
| InChIKey | UBWCRILTBKAZGW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-hydroxy-3,3-dimethyl-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3,3-dimethyl-1H-isoindole?
The IUPAC name of 2-hydroxy-3,3-dimethyl-1H-isoindole (CID 23635567) is 2-hydroxy-3,3-dimethyl-1H-isoindole.
What is the SMILES notation for 2-hydroxy-3,3-dimethyl-1H-isoindole?
The canonical SMILES for 2-hydroxy-3,3-dimethyl-1H-isoindole is CC1(C)c2ccccc2CN1O.
What is the InChIKey of 2-hydroxy-3,3-dimethyl-1H-isoindole?
The InChIKey is UBWCRILTBKAZGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-10(2)9-6-4-3-5-8(9)7-11(10)12/h3-6,12H,7H2,1-2H3.
What are the key properties of 2-hydroxy-3,3-dimethyl-1H-isoindole?
2-hydroxy-3,3-dimethyl-1H-isoindole has a molecular weight of 163.22 g/mol, XLogP of 2.13, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3,3-dimethyl-1H-isoindole is sourced from PubChem (CID 23635567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).