C28H38O4Si — CID 23635573
(E,4R)-4-[(4S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]pent-2-enal (PubChem CID 23635573) has the molecular formula C28H38O4Si and a molecular weight of 466.69 g/mol. Its IUPAC name is (E,4R)-4-[(4S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]pent-2-enal.
| Compound Name | (E,4R)-4-[(4S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]pent-2-enal |
|---|---|
| PubChem CID | 23635573 |
| Molecular Formula | C28H38O4Si |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | (E,4R)-4-[(4S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]pent-2-enal |
| SMILES | C[C@H](/C=C/C=O)[C@@H]1C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C28H38O4Si/c1-22(14-13-19-29)26-20-23(31-28(5,6)32-26)21-30-33(27(2,3)4,24-15-9-7-10-16-24)25-17-11-8-12-18-25/h7-19,22-23,26H,20-21H2,1-6H3/b14-13+/t22-,23+,26+/m1/s1 |
| InChIKey | QDGPPQPIICBWDQ-LFGYQTHYSA-N |
| XLogP | 4.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|