C28H46N2O4 — CID 23635620
N-[(1R,6S,7S,8R,11R,12S,14R,15S,16R)-15-[(1S)-1-(dimethylamino)ethyl]-14-hydroxy-7-(hydroxymethyl)-7,12,16-trimethyl-18-oxo-6-tetracyclo[9.7.0.03,8.012,16]octadec-3-enyl]acetamide (PubChem CID 23635620) has the molecular formula C28H46N2O4 and a molecular weight of 474.69 g/mol. Its IUPAC name is N-[(1R,6S,7S,8R,11R,12S,14R,15S,16R)-15-[(1S)-1-(dimethylamino)ethyl]-14-hydroxy-7-(hydroxymethyl)-7,12,16-trimethyl-18-oxo-6-tetracyclo[9.7.0.03,8.012,16]octadec-3-enyl]acetamide.
| Compound Name | N-[(1R,6S,7S,8R,11R,12S,14R,15S,16R)-15-[(1S)-1-(dimethylamino)ethyl]-14-hydroxy-7-(hydroxymethyl)-7,12,16-trimethyl-18-oxo-6-tetracyclo[9.7.0.03,8.012,16]octadec-3-enyl]acetamide |
|---|---|
| PubChem CID | 23635620 |
| Molecular Formula | C28H46N2O4 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 474.35 |
| IUPAC Name | N-[(1R,6S,7S,8R,11R,12S,14R,15S,16R)-15-[(1S)-1-(dimethylamino)ethyl]-14-hydroxy-7-(hydroxymethyl)-7,12,16-trimethyl-18-oxo-6-tetracyclo[9.7.0.03,8.012,16]octadec-3-enyl]acetamide |
| SMILES | CC(=O)N[C@H]1CC=C2C[C@H]3C(=O)C[C@]4(C)[C@@H]([C@H](C)N(C)C)[C@H](O)C[C@@]4(C)[C@@H]3CC[C@H]2[C@]1(C)CO |
| InChI | InChI=1S/C28H46N2O4/c1-16(30(6)7)25-23(34)14-27(4)21-10-9-20-18(12-19(21)22(33)13-28(25,27)5)8-11-24(29-17(2)32)26(20,3)15-31/h8,16,19-21,23-25,31,34H,9-15H2,1-7H3,(H,29,32)/t16-,19+,20+,21+,23+,24-,25-,26-,27-,28+/m0/s1 |
| InChIKey | GJZDZBAJJBRPMT-HUASUHLISA-N |
| XLogP | 3.17 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|