About [4-[(3,5-dichloro-2-pyridinyl)oxy]phenyl] pyrrolidine-1-carboxylate
[4-[(3,5-dichloro-2-pyridinyl)oxy]phenyl] pyrrolidine-1-carboxylate (PubChem CID 23635768) has the molecular formula C16H14Cl2N2O3
and a molecular weight of 353.21 g/mol. Its IUPAC name is [4-[(3,5-dichloro-2-pyridinyl)oxy]phenyl] pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | [4-[(3,5-dichloro-2-pyridinyl)oxy]phenyl] pyrrolidine-1-carboxylate |
| PubChem CID | 23635768 |
| Molecular Formula | C16H14Cl2N2O3 |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | [4-[(3,5-dichloro-2-pyridinyl)oxy]phenyl] pyrrolidine-1-carboxylate |
| SMILES | O=C(Oc1ccc(Oc2ncc(Cl)cc2Cl)cc1)N1CCCC1 |
| InChI | InChI=1S/C16H14Cl2N2O3/c17-11-9-14(18)15(19-10-11)22-12-3-5-13(6-4-12)23-16(21)20-7-1-2-8-20/h3-6,9-10H,1-2,7-8H2 |
| InChIKey | VEXLNIRUECRPJS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[(3,5-dichloro-2-pyridinyl)oxy]phenyl] pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(3,5-dichloro-2-pyridinyl)oxy]phenyl] pyrrolidine-1-carboxylate?
The IUPAC name of [4-[(3,5-dichloro-2-pyridinyl)oxy]phenyl] pyrrolidine-1-carboxylate (CID 23635768) is [4-[(3,5-dichloro-2-pyridinyl)oxy]phenyl] pyrrolidine-1-carboxylate.
What is the SMILES notation for [4-[(3,5-dichloro-2-pyridinyl)oxy]phenyl] pyrrolidine-1-carboxylate?
The canonical SMILES for [4-[(3,5-dichloro-2-pyridinyl)oxy]phenyl] pyrrolidine-1-carboxylate is O=C(Oc1ccc(Oc2ncc(Cl)cc2Cl)cc1)N1CCCC1.
What is the InChIKey of [4-[(3,5-dichloro-2-pyridinyl)oxy]phenyl] pyrrolidine-1-carboxylate?
The InChIKey is VEXLNIRUECRPJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Cl2N2O3/c17-11-9-14(18)15(19-10-11)22-12-3-5-13(6-4-12)23-16(21)20-7-1-2-8-20/h3-6,9-10H,1-2,7-8H2.
What are the key properties of [4-[(3,5-dichloro-2-pyridinyl)oxy]phenyl] pyrrolidine-1-carboxylate?
[4-[(3,5-dichloro-2-pyridinyl)oxy]phenyl] pyrrolidine-1-carboxylate has a molecular weight of 353.21 g/mol, XLogP of 4.78, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(3,5-dichloro-2-pyridinyl)oxy]phenyl] pyrrolidine-1-carboxylate is sourced from PubChem (CID 23635768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).