C17H20BrNO2 — CID 23635863
7-(4-methoxyanilino)-5,6,7,8-tetrahydronaphthalen-2-ol;hydrobromide (PubChem CID 23635863) has the molecular formula C17H20BrNO2 and a molecular weight of 350.26 g/mol. Its IUPAC name is 7-(4-methoxyanilino)-5,6,7,8-tetrahydronaphthalen-2-ol;hydrobromide.
| Compound Name | 7-(4-methoxyanilino)-5,6,7,8-tetrahydronaphthalen-2-ol;hydrobromide |
|---|---|
| PubChem CID | 23635863 |
| Molecular Formula | C17H20BrNO2 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 7-(4-methoxyanilino)-5,6,7,8-tetrahydronaphthalen-2-ol;hydrobromide |
| SMILES | Br.COc1ccc(NC2CCc3ccc(O)cc3C2)cc1 |
| InChI | InChI=1S/C17H19NO2.BrH/c1-20-17-8-5-14(6-9-17)18-15-4-2-12-3-7-16(19)11-13(12)10-15;/h3,5-9,11,15,18-19H,2,4,10H2,1H3;1H |
| InChIKey | YTOAMVAUPXJVJC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|